For research use only. Not for therapeutic Use.
3-Methoxycinnamic acid(Cat No.:M082818)is a naturally derived cinnamic acid derivative featuring a methoxy group at the 3-position on the aromatic ring. This compound is widely used in pharmaceutical, cosmetic, and food industries due to its antioxidant, anti-inflammatory, and UV-absorbing properties. In medicinal chemistry, it serves as a precursor for the synthesis of various bioactive molecules, including drugs and natural product analogs. Its structure allows for further functionalization, making it a versatile intermediate in organic synthesis. High purity ensures its effectiveness in advanced research and commercial applications.
Catalog Number | M082818 |
CAS Number | 17570-26-2 |
Molecular Formula | C10H10O3 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | (E)-3-(3-methoxyphenyl)prop-2-enoic acid |
InChI | InChI=1S/C10H10O3/c1-13-9-4-2-3-8(7-9)5-6-10(11)12/h2-7H,1H3,(H,11,12)/b6-5+ |
InChIKey | LZPNXAULYJPXEH-AATRIKPKSA-N |
SMILES | COC1=CC=CC(=C1)/C=C/C(=O)O |