For research use only. Not for therapeutic Use.
3-Methoxycyclobutan-1-one is an organic compound with the molecular formula C₅H₈O₂. It features a cyclobutane ring with a methoxy group at the 3-position and a carbonyl group (ketone) at the 1-position. This compound typically appears as a colorless liquid and is of interest in organic synthesis due to its unique structural properties. Its reactivity allows for various transformations, making it a valuable intermediate in the synthesis of pharmaceuticals and fine chemicals. Additionally, it may possess interesting biological activities worth exploring.
CAS Number | 30830-25-2 |
Molecular Formula | C5H8O2 |
Purity | ≥95% |
IUPAC Name | 3-methoxycyclobutan-1-one |
InChI | InChI=1S/C5H8O2/c1-7-5-2-4(6)3-5/h5H,2-3H2,1H3 |
InChIKey | LZKSSLYIICHJEO-UHFFFAOYSA-N |
SMILES | COC1CC(=O)C1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |