For research use only. Not for therapeutic Use.
3-Methoxyphenethyl bromide（Cat No.:L006841）, is an organic compound containing a phenethyl group attached to a methoxy group and a bromine atom. This compound is used as a versatile building block in organic synthesis and medicinal chemistry. It is employed in the preparation of various biologically active molecules, pharmaceuticals, and agrochemicals. Chemists utilize its reactivity to introduce specific functional groups, enabling the creation of diverse organic compounds.
| Catalog Number | L006841 |
| CAS Number | 2146-61-4 |
| Molecular Formula | C9H11BrO |
| Purity | ≥95% |
| IUPAC Name | 1-(2-bromoethyl)-3-methoxybenzene |
| InChI | InChI=1S/C9H11BrO/c1-11-9-4-2-3-8(7-9)5-6-10/h2-4,7H,5-6H2,1H3 |
| InChIKey | LQDHVNHVHAYANB-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)CCBr |
