For research use only. Not for therapeutic Use.
3-Methoxyphenoxyacetic acid(CAT: L017632) is a high-purity aromatic compound featuring a methoxy-substituted phenoxy group attached to an acetic acid moiety. This versatile molecule is widely utilized in pharmaceutical and agrochemical research as a key intermediate in the synthesis of bioactive compounds, including herbicides, fungicides, and therapeutic agents. Its well-defined structure and functional groups enable diverse chemical transformations, making it suitable for advanced material development and fine chemical production. 3-Methoxyphenoxyacetic acid is a reliable building block for innovative research in medicinal chemistry and organic synthesis.
CAS Number | 2088-24-6 |
Molecular Formula | C9H10O4 |
Purity | ≥95% |
IUPAC Name | 2-(3-methoxyphenoxy)acetic acid |
InChI | InChI=1S/C9H10O4/c1-12-7-3-2-4-8(5-7)13-6-9(10)11/h2-5H,6H2,1H3,(H,10,11) |
InChIKey | AHDPQRIYMMZJTF-UHFFFAOYSA-N |
SMILES | COC1=CC(=CC=C1)OCC(=O)O |