For research use only. Not for therapeutic Use.
3-Methoxyphenylacetyl chloride(CAT: L014836) is a high-purity aromatic acyl chloride featuring a methoxy group on a phenyl ring and an acetyl chloride functionality. This versatile compound serves as a critical intermediate in pharmaceutical research and organic synthesis, particularly for the development of bioactive molecules, amides, and esters. Its reactive acyl chloride group enables efficient coupling with nucleophiles such as amines and alcohols, facilitating the synthesis of complex intermediates, small-molecule inhibitors, and fine chemicals. 3-Methoxyphenylacetyl chloride is ideal for precision applications in medicinal chemistry, offering reliability and efficiency for both academic and industrial research.
CAS Number | 6834-42-0 |
Molecular Formula | C9H9ClO2 |
Purity | ≥95% |
IUPAC Name | 2-(3-methoxyphenyl)acetyl chloride |
InChI | InChI=1S/C9H9ClO2/c1-12-8-4-2-3-7(5-8)6-9(10)11/h2-5H,6H2,1H3 |
InChIKey | UZUYKYNVSJTWEH-UHFFFAOYSA-N |
SMILES | COC1=CC=CC(=C1)CC(=O)Cl |