For research use only. Not for therapeutic Use.
3-Methoxypropanoyl chloride（Cat No.:L006754）. It consists of a propanoyl group (a three-carbon chain with a carbonyl group) and a methoxy group (-OCH3) attached at the 3-position. This compound is a reactive acylating agent used in organic synthesis to introduce the propanoyl group into various organic molecules. It finds applications in the preparation of pharmaceuticals, agrochemicals, and specialty chemicals. Its reactivity makes it valuable in the creation of complex molecules, allowing researchers to design and synthesize a wide range of functionalized organic compounds for various applications in chemical research and industry.
| Catalog Number | L006754 |
| CAS Number | 4244-59-1 |
| Molecular Formula | C4H7ClO2 |
| Purity | ≥95% |
| IUPAC Name | 3-methoxypropanoyl chloride |
| InChI | InChI=1S/C4H7ClO2/c1-7-3-2-4(5)6/h2-3H2,1H3 |
| InChIKey | JSMDUOFOPDSKIQ-UHFFFAOYSA-N |
| SMILES | COCCC(=O)Cl |
