Home
>
Chemical Reagents>Organic Building Blocks> 3-Methyl-1-(2,6,6-trimethylcyclohex-1-en-1-yl)penta-1,4-dien-3-ol
For research use only. Not for therapeutic Use.
3-Methyl-1-(2,6,6-trimethylcyclohex-1-en-1-yl)penta-1,4-dien-3-ol(Cat No.:L040556)is a complex organic compound featuring a cyclohexene ring with three methyl groups and a conjugated diene system. This structure imparts unique chemical properties, making it valuable in organic synthesis and material science. It is often used as an intermediate in the production of natural products, fragrances, and pharmaceuticals, where its specific configuration allows for selective reactions and the creation of intricate molecular architectures. Its versatility and reactivity make it an essential compound for advanced chemical research.
CAS Number | 5208-93-5 |
Molecular Formula | C15H24O |
Purity | ≥95% |
IUPAC Name | (1E)-3-methyl-1-(2,6,6-trimethylcyclohexen-1-yl)penta-1,4-dien-3-ol |
InChI | InChI=1S/C15H24O/c1-6-15(5,16)11-9-13-12(2)8-7-10-14(13,3)4/h6,9,11,16H,1,7-8,10H2,2-5H3/b11-9+ |
InChIKey | PZGYHDPZANRCSM-PKNBQFBNSA-N |
SMILES | CC1=C(C(CCC1)(C)C)C=CC(C)(C=C)O |