For research use only. Not for therapeutic Use.
3-Methyl-1-butyl-d11 Alcohol(Cat No.:M044698) is a high-purity, deuterated compound essential for advanced biochemical and pharmaceutical research. This isotopically labeled version of 3-Methyl-1-butyl Alcohol features eleven deuterium atoms, allowing for precise tracking in metabolic and analytical studies. Its stable isotope labeling ensures accurate and reproducible results, making it ideal for use in NMR spectroscopy, mass spectrometry, and other sophisticated analytical techniques. This compound is crucial for researchers focusing on alcohol metabolism, organic synthesis, and pharmacokinetics, offering a robust and reliable solution for high-precision scientific investigations.
Catalog Number | M044698 |
CAS Number | 170678-50-9 |
Synonyms | 3-METHYL-1-BUTYL-D11 ALCOHOL |
Molecular Formula | C5H12O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1,1,2,2,3,4,4,4-octadeuterio-3-(trideuteriomethyl)butan-1-ol |
InChI | InChI=1S/C5H12O/c1-5(2)3-4-6/h5-6H,3-4H2,1-2H3/i1D3,2D3,3D2,4D2,5D |
InChIKey | PHTQWCKDNZKARW-KUXNVAAFSA-N |
SMILES | CC(C)CCO |