For research use only. Not for therapeutic Use.
3-Methyl-1-indanone(CAT: L039757) is an organic compound that features a methyl group attached to an indanone core structure, which combines an aromatic ring with a cyclic ketone. Known for its distinctive structural framework, this compound is often utilized as a starting material or intermediate in organic synthesis, particularly in the pharmaceutical industry, where it serves as a building block for developing biologically active molecules. The ketone group enhances its reactivity, enabling a range of chemical modifications, while the methyl substitution adds to its steric properties. 3-Methyl-1-indanone is valued in research for its potential applications in drug discovery, synthesis of complex heterocycles, and development of novel therapeutic agents.
CAS Number | 6072-57-7 |
Molecular Formula | C10H10O |
Purity | ≥95% |
IUPAC Name | 3-methyl-2,3-dihydroinden-1-one |
InChI | InChI=1S/C10H10O/c1-7-6-10(11)9-5-3-2-4-8(7)9/h2-5,7H,6H2,1H3 |
InChIKey | XVTQSYKCADSUHN-UHFFFAOYSA-N |