Home
>
Chemical Reagents>Heterocyclic Building Blocks> 3-Methyl-1-(naphthalen-1-yl)butan-1-amine hydrochloride
For research use only. Not for therapeutic Use.
3-Methyl-1-(naphthalen-1-yl)butan-1-amine hydrochloride(Cat No.:L007738), is a chemical compound used in scientific research and pharmaceutical development. It consists of a butylamine chain (C7H17N) with a methyl group (CH3) attached to the third carbon and a naphthalen-1-yl group attached to the first carbon. The compound is commonly found in various chemical databases and research literature, showcasing its importance in organic chemistry studies. Its hydrochloride form enhances its stability and solubility, making it suitable for laboratory experiments and pharmaceutical applications. Researchers use this compound to explore its interactions with biological systems and assess its potential therapeutic properties.
CAS Number | 1204595-16-3 |
Molecular Formula | C15H20ClN |
Purity | ≥95% |
IUPAC Name | 3-methyl-1-naphthalen-1-ylbutan-1-amine;hydrochloride |
InChI | InChI=1S/C15H19N.ClH/c1-11(2)10-15(16)14-9-5-7-12-6-3-4-8-13(12)14;/h3-9,11,15H,10,16H2,1-2H3;1H |
InChIKey | RRHFHGWIRLRBQB-UHFFFAOYSA-N |
SMILES | CC(C)CC(C1=CC=CC2=CC=CC=C21)N.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |