For research use only. Not for therapeutic Use.
3-Methyl-1-(p-tolyl) butane-1-amine hydrochloride（Cat No.:L007799）, is a chemical compound with applications in various research and industrial fields. This compound consists of a tertiary amine group attached to a butyl chain, with a p-tolyl substituent, and is in its hydrochloride salt form. Such compounds find utility in organic synthesis, medicinal chemistry, and pharmaceutical research.
| Catalog Number | L007799 |
| CAS Number | 1219455-77-2 |
| Molecular Formula | C12H20ClN |
| Purity | ≥95% |
| IUPAC Name | 3-methyl-1-(4-methylphenyl)butan-1-amine;hydrochloride |
| InChI | InChI=1S/C12H19N.ClH/c1-9(2)8-12(13)11-6-4-10(3)5-7-11;/h4-7,9,12H,8,13H2,1-3H3;1H |
| InChIKey | AMYZGAAKUNKRKD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(CC(C)C)N.Cl |
