For research use only. Not for therapeutic Use.
3-Methyl-1-phenyl-2-phospholene 1-oxide(Cat No.:L007024), is a phosphorus-containing organic compound. Its chemical structure features a phospholene oxide ring with a methyl group and a phenyl group attached. This compound is essential in organic synthesis, particularly in the preparation of various phosphorus-containing ligands and catalysts used in coordination chemistry and asymmetric synthesis. It serves as a versatile building block for the development of novel materials, pharmaceuticals, and agrochemicals. The unique properties of phosphorene oxides make them valuable in the design and synthesis of specialized molecules, contributing significantly to research in the fields of chemistry, materials science, and catalysis.
CAS Number | 707-61-9 |
Molecular Formula | C11H13OP |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 4-methyl-1-phenyl-2,3-dihydro-1位5-phosphole 1-oxide |
InChI | InChI=1S/C11H13OP/c1-10-7-8-13(12,9-10)11-5-3-2-4-6-11/h2-6,9H,7-8H2,1H3 |
InChIKey | YMKWWHFRGALXLE-UHFFFAOYSA-N |
SMILES | CC1=CP(=O)(CC1)C2=CC=CC=C2 |