For research use only. Not for therapeutic Use.
3-Methyl-1,4,2-dioxazol-5-one(CAT: L000413) is a significant compound primarily used in organic chemistry. This molecule serves as a key intermediate in various organic reactions and the synthesis of specialized organic compounds. Its unique dioxazolone structure is valuable for introducing functional groups and modifying organic molecules, making it essential for designing and producing novel compounds with tailored properties.
CAS Number | 854849-14-2 |
Molecular Formula | C3H3NO3 |
Purity | ≥95% |
IUPAC Name | 3-methyl-1,4,2-dioxazol-5-one |
InChI | InChI=1S/C3H3NO3/c1-2-4-7-3(5)6-2/h1H3 |
InChIKey | BQZIJUVIVNXFIC-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |