For research use only. Not for therapeutic Use.
3-Methyl-1H-indole-d8 (Cat.No:R023803) is a deuterated derivative of 3-Methyl-1H-indole, a chemical compound commonly used in organic synthesis and pharmaceutical research. The “-d8” indicates that eight hydrogen atoms in the molecule are replaced with deuterium, a stable isotope of hydrogen. This labeled compound is employed as a reference standard and tracer in various analytical and pharmacological studies.
CAS Number | 697807-03-7 |
Synonyms | β-Methylindole-d8; Scatole-d8; Skatol-d8; Skatole-d8; NSC 122024-d8; |
Molecular Formula | C9H9N |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 2,4,5,6,7-pentadeuterio-3-(trideuteriomethyl)-1H-indole |
InChI | InChI=1S/C9H9N/c1-7-6-10-9-5-3-2-4-8(7)9/h2-6,10H,1H3/i1D3,2D,3D,4D,5D,6D |
InChIKey | ZFRKQXVRDFCRJG-JGUCLWPXSA-N |
SMILES | CC1=CNC2=CC=CC=C12 |