For research use only. Not for therapeutic Use.
3-Methyl-2-butanone is a high-purity compound essential for advanced pharmaceutical and chemical research. This ketone is crucial for studies involving organic synthesis, solvent applications, and chemical intermediates. Known for its stability and reactivity, it integrates seamlessly into experimental protocols, providing reliable and consistent results for high-precision investigations in various scientific applications.
CAS Number | 563-80-4 |
Synonyms | 2-Acetylpropane; 2-Methylbutan-3-one; 3-Methyl-2-butanone; Isopropyl Methyl Ketone; MIPK; Methyl Isopropyl Ketone; NSC 9379 |
Molecular Formula | C5H10O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3-methylbutan-2-one |
InChI | InChI=1S/C5H10O/c1-4(2)5(3)6/h4H,1-3H3 |
InChIKey | SYBYTAAJFKOIEJ-UHFFFAOYSA-N |
SMILES | CC(C)C(=O)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |