For research use only. Not for therapeutic Use.
3-Methyl-2-cyclopenten-1-one(Cat No.:I015099) is an endogenous metabolite that is naturally produced within the body as part of various metabolic processes. It is a cyclic ketone with a methyl group attached to the carbon ring. This compound has been detected in biological fluids and tissues and is involved in different biochemical pathways. Although its specific functions and roles are still being investigated, the presence of 3-Methyl-2-cyclopenten-1-one suggests its potential significance in physiological processes and cellular metabolism.
CAS Number | 2758-18-1 |
Molecular Formula | C₆H₈O |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | 2-8°C |
IUPAC Name | 3-methylcyclopent-2-en-1-one |
InChI | InChI=1S/C6H8O/c1-5-2-3-6(7)4-5/h4H,2-3H2,1H3 |
InChIKey | CHCCBPDEADMNCI-UHFFFAOYSA-N |
SMILES | CC1=CC(=O)CC1 |