For research use only. Not for therapeutic Use.
3-Methyl-2-naphthoic acid(CAT: L012073) is an aromatic organic compound featuring a naphthalene ring system with a methyl group at the 3-position and a carboxylic acid group at the 2-position. This structure, combining a naphthalene core with an acidic functional group, makes it useful in various fields, including organic synthesis and pharmaceutical research. The carboxylic acid group allows for modifications like esterification and amide formation, making it a versatile intermediate for creating complex organic molecules. Due to its planar aromatic structure, 3-methyl-2-naphthoic acid is also studied in materials science, particularly in developing compounds with specific photophysical properties. In medicinal chemistry, it serves as a precursor in synthesizing bioactive naphthalene derivatives, such as antimicrobial and anti-inflammatory agents.
CAS Number | 39110-32-2 |
Molecular Formula | C12H10O2 |
Purity | ≥95% |
IUPAC Name | 3-methylnaphthalene-2-carboxylic acid |
InChI | InChI=1S/C12H10O2/c1-8-6-9-4-2-3-5-10(9)7-11(8)12(13)14/h2-7H,1H3,(H,13,14) |
InChIKey | JFBYGMUJXBUWEO-UHFFFAOYSA-N |