For research use only. Not for therapeutic Use.
(3-Methyl-2-nitro-3H-imidazol-4-yl)methanol is an imidazole derivative notable for its potential biological activity. This compound features a nitro group and a methyl substituent on the imidazole ring, which may influence its pharmacological properties. It is of interest in medicinal chemistry due to its potential applications as an antimicrobial or anticancer agent. Ongoing research is focused on understanding its mechanisms of action and optimizing its activity, making it a valuable candidate for the development of new therapeutic agents.
CAS Number | 39070-14-9 |
Synonyms | 1-Methyl-2-nitroimidazole-5-methanol; 5-(Hydroxymethyl)-1-methyl-2-nitroimidazole;?L 8938; NSC 307224; SR 2521 |
Molecular Formula | C5H7N3O3 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | (3-methyl-2-nitroimidazol-4-yl)methanol |
InChI | InChI=1S/C5H7N3O3/c1-7-4(3-9)2-6-5(7)8(10)11/h2,9H,3H2,1H3 |
InChIKey | WXSSUDRHAJTESR-UHFFFAOYSA-N |
SMILES | CN1C(=CN=C1[N+](=O)[O-])CO |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |