For research use only. Not for therapeutic Use.
3-Methyl-2,5-oxazolidinedione(CAT: R015332) is a heterocyclic organic compound and a derivative of oxazolidinedione. It is primarily known for its use as an anticonvulsant in the treatment of epilepsy. The compound acts by modulating ion channels, particularly inhibiting sodium and calcium channel activity, which helps reduce neuronal excitability and prevent seizures. Its structure allows for high selectivity in targeting central nervous system activity, making it useful in neurological research. In addition to its pharmaceutical applications, 3-Methyl-2,5-oxazolidinedione is studied in organic chemistry for its reactivity and potential as a building block for other biologically active molecules.
CAS Number | 5840-76-6 |
Synonyms | N-carboxy-N-methylglycine Cyclic Anhydride; N-Carboxysarcosine anhydride; N-Methylglycine N-carboxy anhydride; Sarcosine N-carboxyanhydride |
Molecular Formula | C4H5NO3 |
Purity | ≥95% |
Storage | Desiccate at RT |
IUPAC Name | 3-methyl-1,3-oxazolidine-2,5-dione |
InChI | InChI=1S/C4H5NO3/c1-5-2-3(6)8-4(5)7/h2H2,1H3 |
InChIKey | PMPAXURTFMSZSN-UHFFFAOYSA-N |
SMILES | CN1CC(=O)OC1=O |