For research use only. Not for therapeutic Use.
3-Methyl-5-(morpholin-4-yl)pyridin-2-amine(Cat No.:L007556), is a chemical compound featuring a pyridine ring substituted with a methyl group at the 3rd position, an amino group at the 2nd position, and a morpholin-4-yl group at the 5th position. This compound is significant in medicinal chemistry, serving as a structural motif in drug design. Its unique arrangement suggests potential pharmacological activities, making it valuable for further exploration in pharmaceutical research.
CAS Number | 1554988-88-3 |
Molecular Formula | C10H15N3O |
Purity | ≥95% |
IUPAC Name | 3-methyl-5-morpholin-4-ylpyridin-2-amine |
InChI | InChI=1S/C10H15N3O/c1-8-6-9(7-12-10(8)11)13-2-4-14-5-3-13/h6-7H,2-5H2,1H3,(H2,11,12) |
InChIKey | KYUXNVVEMYPUMU-UHFFFAOYSA-N |
SMILES | CC1=CC(=CN=C1N)N2CCOCC2 |