For research use only. Not for therapeutic Use.
3-Methyl-5-nitrobenzaldehyde(CAT: L033912) is an aromatic aldehyde featuring a methyl group at the 3-position and a nitro group at the 5-position on a benzene ring. This compound is widely used in pharmaceutical and chemical research as a key intermediate for synthesizing bioactive molecules, including heterocyclic compounds and therapeutic candidates. Its electron-withdrawing nitro group and aldehyde functionality enable versatile chemical transformations, making it suitable for a variety of synthetic pathways. With high purity and stability, 3-Methyl-5-nitrobenzaldehyde is a valuable building block for advanced organic synthesis and medicinal chemistry projects.
CAS Number | 107757-06-2 |
Molecular Formula | C8H7NO3 |
Purity | ≥95% |
IUPAC Name | 3-methyl-5-nitrobenzaldehyde |
InChI | InChI=1S/C8H7NO3/c1-6-2-7(5-10)4-8(3-6)9(11)12/h2-5H,1H3 |
InChIKey | JXJUTTOJJMSVBB-UHFFFAOYSA-N |
SMILES | CC1=CC(=CC(=C1)[N+](=O)[O-])C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |