For research use only. Not for therapeutic Use.
3-Methyl-5-nitrobenzoisothiazole(Cat No.:L014813)is a heterocyclic aromatic compound utilized in pharmaceutical and chemical research. This molecule features a methyl group at the 3-position and a nitro group at the 5-position on the benzoisothiazole ring, providing unique reactivity and making it a valuable intermediate in synthesizing bioactive molecules. It is particularly useful in developing antimicrobial agents, dyes, and other specialty chemicals. The compound’s distinct structure allows for the exploration of new chemical pathways, contributing to advancements in drug discovery and the development of novel therapeutic agents.
Catalog Number | L014813 |
CAS Number | 35272-19-6 |
Molecular Formula | C8H6N2O2S |
Purity | ≥95% |
IUPAC Name | 3-methyl-5-nitro-1,2-benzothiazole |
InChI | InChI=1S/C8H6N2O2S/c1-5-7-4-6(10(11)12)2-3-8(7)13-9-5/h2-4H,1H3 |
InChIKey | UUOMNUMWKBVHNG-UHFFFAOYSA-N |
SMILES | CC1=NSC2=C1C=C(C=C2)[N+](=O)[O-] |