Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> 3-Methyl-5-(piperidin-4-yl)pyridine
For research use only. Not for therapeutic Use.
3-Methyl-5-(piperidin-4-yl)pyridine(Cat No.: L007249) is a heterocyclic compound with notable pharmacological attributes. It functions as a modulator, exerting its action by interacting with specific receptors or enzymes within biological systems. Its pharmacological effects include the regulation of signaling pathways associated with certain physiological processes. Due to its distinctive structure and mode of action, this chemical holds potential applications in drug discovery and medicinal chemistry, where its interactions can be harnessed to develop innovative therapeutic interventions for various disorders or conditions.
CAS Number | 1256804-61-1 |
Molecular Formula | C11H16N2 |
Purity | ≥95% |
IUPAC Name | 3-methyl-5-piperidin-4-ylpyridine |
InChI | InChI=1S/C11H16N2/c1-9-6-11(8-13-7-9)10-2-4-12-5-3-10/h6-8,10,12H,2-5H2,1H3 |
InChIKey | NRALKTSCMNAXHZ-UHFFFAOYSA-N |
SMILES | CC1=CC(=CN=C1)C2CCNCC2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |