For research use only. Not for therapeutic Use.
3-Methyl-6-(trifluoromethyl)pyridin-2-amine (Cat.No:L004174) is a pivotal compound in medicinal chemistry. Its unique structure, featuring a methylated pyridine core and trifluoromethyl group, offers specialized pharmacological potential. This compound serves as a valuable scaffold in the development of bioactive molecules, particularly in the field of pharmaceuticals.
Catalog Number | L004174 |
CAS Number | 1211582-57-8 |
Molecular Formula | C7H7F3N2 |
Purity | ≥95% |
IUPAC Name | 3-methyl-6-(trifluoromethyl)pyridin-2-amine |
InChI | InChI=1S/C7H7F3N2/c1-4-2-3-5(7(8,9)10)12-6(4)11/h2-3H,1H3,(H2,11,12) |
InChIKey | SURNWXZZAOHVMI-UHFFFAOYSA-N |
SMILES | CC1=C(N=C(C=C1)C(F)(F)F)N |