For research use only. Not for therapeutic Use.
(3-Methyl-benzyl)-pyridin-3-ylmethyl-amine(Cat No.:L006844), is an important chemical compound in medicinal chemistry. Its molecular structure includes a 3-methylbenzyl group and a pyridin-3-ylmethylamine moiety, making it a key intermediate in the synthesis of various biologically active molecules. Researchers often use this compound to develop potential pharmaceuticals and study structure-activity relationships. The specific arrangement of its functional groups offers opportunities for diverse chemical modifications, enabling the creation of targeted drugs.
CAS Number | 510723-59-8 |
Molecular Formula | C14H16N2 |
Purity | ≥95% |
IUPAC Name | N-[(3-methylphenyl)methyl]-1-pyridin-3-ylmethanamine |
InChI | InChI=1S/C14H16N2/c1-12-4-2-5-13(8-12)9-16-11-14-6-3-7-15-10-14/h2-8,10,16H,9,11H2,1H3 |
InChIKey | MSSMWYIHERFESM-UHFFFAOYSA-N |
SMILES | CC1=CC(=CC=C1)CNCC2=CN=CC=C2 |