For research use only. Not for therapeutic Use.
3-Methyl-d3-indole（Cat No.:R023796） is a high-purity deuterated compound crucial for advanced research in organic chemistry and biochemistry. Featuring three deuterium atoms, this isotopically labeled version of 3-methylindole is essential for studying metabolic pathways, biosynthesis, and reaction mechanisms. Its precise isotope labeling ensures accurate and reliable analytical results, enhancing the quality of experimental data. 3-Methyl-d3-indole is widely used in investigations involving tryptophan metabolism, microbial studies, and synthetic applications.
| Catalog Number | R023796 |
| CAS Number | 111399-60-1 |
| Synonyms | 3-(Methyl-d3)-1H-indole |
| Molecular Formula | C9H9N |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | 3-(trideuteriomethyl)-1H-indole |
| InChI | InChI=1S/C9H9N/c1-7-6-10-9-5-3-2-4-8(7)9/h2-6,10H,1H3/i1D3 |
| InChIKey | ZFRKQXVRDFCRJG-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=CNC2=CC=CC=C21 |
