For research use only. Not for therapeutic Use.
3-Methyl-d3-indole(Cat No.:R023796) is a high-purity deuterated compound crucial for advanced research in organic chemistry and biochemistry. Featuring three deuterium atoms, this isotopically labeled version of 3-methylindole is essential for studying metabolic pathways, biosynthesis, and reaction mechanisms. Its precise isotope labeling ensures accurate and reliable analytical results, enhancing the quality of experimental data. 3-Methyl-d3-indole is widely used in investigations involving tryptophan metabolism, microbial studies, and synthetic applications.
CAS Number | 111399-60-1 |
Synonyms | 3-(Methyl-d3)-1H-indole |
Molecular Formula | C9H9N |
Purity | ≥95% |
Target | MAPK/ERK Pathway |
Storage | Store at RT |
IUPAC Name | 3-(trideuteriomethyl)-1H-indole |
InChI | InChI=1S/C9H9N/c1-7-6-10-9-5-3-2-4-8(7)9/h2-6,10H,1H3/i1D3 |
InChIKey | ZFRKQXVRDFCRJG-FIBGUPNXSA-N |
SMILES | [2H]C([2H])([2H])C1=CNC2=CC=CC=C21 |