For research use only. Not for therapeutic Use.
3-Methylbenzaldehyde (Cat No.:R039431), also known as m-Tolualdehyde, 3-Tolualdehyde, NSC 1244, NSC 89859, m-Formyltoluene is a toluene formaldehyde compound with the methyl substituent at position 3, which can be used as a food additive. It is also used as an intermediate in organic synthesis.
| Catalog Number | R039431 |
| CAS Number | 620-23-5 |
| Synonyms | m-Tolualdehyde; 3-Methylphenylcarboxaldehyde; 3-Tolualdehyde; NSC 1244; NSC 89859; m-Formyltoluene; m-Methylbenzaldehyde; |
| Molecular Formula | C8H8O |
| Purity | ≥95% |
| Target | Anti-infection |
| Storage | -20°C |
| IUPAC Name | 3-methylbenzaldehyde |
| InChI | InChI=1S/C8H8O/c1-7-3-2-4-8(5-7)6-9/h2-6H,1H3 |
| InChIKey | OVWYEQOVUDKZNU-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC(=C1)C=O |
