For research use only. Not for therapeutic Use.
3-Methylcyclohexylamine（Cat No.:L006898）, is a valuable organic compound used in chemical synthesis and industrial processes. Its molecular structure includes a cyclohexylamine group with a methyl substituent. This compound is employed as a versatile intermediate in the production of various chemicals, including pharmaceuticals, agrochemicals, and polymers. Its applications extend to the synthesis of rubber accelerators, dyes, and corrosion inhibitors. Due to its diverse reactivity and stability, researchers use it in the development of specialized chemical products.
| Catalog Number | L006898 |
| CAS Number | 6850-35-7 |
| Molecular Formula | C7H15N |
| Purity | ≥95% |
| IUPAC Name | 3-methylcyclohexan-1-amine |
| InChI | InChI=1S/C7H15N/c1-6-3-2-4-7(8)5-6/h6-7H,2-5,8H2,1H3 |
| InChIKey | JYDYHSHPBDZRPU-UHFFFAOYSA-N |
| SMILES | CC1CCCC(C1)N |
