For research use only. Not for therapeutic Use.
3-Methylglutaric acid (Cat No.:I019853) is an organic compound classified as a dicarboxylic acid. It is a derivative of glutaric acid, with a methyl group attached to the third carbon atom. This compound is naturally found in certain fruits and vegetables. 3-Methylglutaric acid is utilized in organic synthesis, particularly in the production of pharmaceuticals and fine chemicals. Its unique structure and reactivity make it a valuable building block for the synthesis of complex organic compounds. Furthermore, it holds potential applications in biochemistry and metabolic research due to its involvement in various biological processes.
| Catalog Number | I019853 |
| CAS Number | 626-51-7 |
| Molecular Formula | C₆H₁₀O₄ |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| Storage | Room Temperature |
| IUPAC Name | 3-methylpentanedioic acid |
| InChI | InChI=1S/C6H10O4/c1-4(2-5(7)8)3-6(9)10/h4H,2-3H2,1H3,(H,7,8)(H,9,10) |
| InChIKey | XJMMNTGIMDZPMU-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)O)CC(=O)O |
| Reference | [1]. Barich DH, et al. 3-Methylglutaric acid as a 13C solid-state NMR standard. Solid State Nucl Magn Reson. 2006 Oct;30(3-4):125-9.<br>[2]. Dylan E Jones, et al. 3-Methylglutaric acid in energy metabolism. Clin Chim Acta. 2020 Mar;502:233-239. |
