For research use only. Not for therapeutic Use.
3-Methylindole（Cat No.:R013367）, is a chemical compound also known as skatole. It is an organic compound with a strong and distinct odor, often described as fecal-like. Skatole is found in various natural sources, including animal feces and certain plants. It is produced in the intestines during the digestion of tryptophan-containing proteins and is responsible for the characteristic smell of feces. Skatole has applications in perfumery and flavoring, but its strong odor limits its use in these industries.
| Catalog Number | R013367 |
| CAS Number | 83-34-1 |
| Synonyms | β-Methylindole; Scatole; Skatol; Skatole; NSC 122024; |
| Molecular Formula | C9H9N |
| Purity | ≥95% |
| Target | MAPK/ERK Pathway |
| Storage | Store at RT |
| IUPAC Name | 3-methyl-1H-indole |
| InChI | InChI=1S/C9H9N/c1-7-6-10-9-5-3-2-4-8(7)9/h2-6,10H,1H3 |
| InChIKey | ZFRKQXVRDFCRJG-UHFFFAOYSA-N |
| SMILES | CC1=CNC2=CC=CC=C12 |
