For research use only. Not for therapeutic Use.
(3-Methylpyrazin-2-yl)methanamine dihydrochloride (Cat.No:L003830) is a significant chemical compound in pharmaceutical research. Its unique pyrazine structure, coupled with an amine moiety, grants it valuable reactivity. This compound is employed as a crucial building block in the synthesis of specialized molecules with applications in drug development. Its versatile nature makes it an essential component in the quest for innovative pharmaceutical agents, highlighting its importance in contemporary medicinal chemistry.
CAS Number | 2288710-30-3 |
Molecular Formula | C6H11Cl2N3 |
Purity | ≥95% |
IUPAC Name | (3-methylpyrazin-2-yl)methanamine;dihydrochloride |
InChI | InChI=1S/C6H9N3.2ClH/c1-5-6(4-7)9-3-2-8-5;;/h2-3H,4,7H2,1H3;2*1H |
InChIKey | BZGRTYMYFTXCDT-UHFFFAOYSA-N |
SMILES | CC1=NC=CN=C1CN.Cl.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |