For research use only. Not for therapeutic Use.
3-(Methylsulfanyl)cyclohexanone(Cat No.:L007864), with the chemical formula C7H12OS. This compound features a cyclohexanone ring substituted with a methylsulfanyl (thiomethyl) group at the 3-position. Compounds with similar sulfur-containing motifs have applications in organic synthesis, often used as intermediates for the preparation of pharmaceuticals, agrochemicals, and fine chemicals. The presence of the sulfur atom provides reactivity, allowing chemists to perform various transformations. Researchers utilize such compounds as building blocks to create complex molecules, contributing to advancements in the field of medicinal chemistry, materials science, and other scientific disciplines.
CAS Number | 22842-45-1 |
Molecular Formula | C7H12OS |
Purity | ≥95% |
IUPAC Name | 3-methylsulfanylcyclohexan-1-one |
InChI | InChI=1S/C7H12OS/c1-9-7-4-2-3-6(8)5-7/h7H,2-5H2,1H3 |
InChIKey | GNVOLBGMDFEMPH-UHFFFAOYSA-N |
SMILES | CSC1CCCC(=O)C1 |