For research use only. Not for therapeutic Use.
3-Methyluridine Cat No.: I019869) is a modified nucleoside derived from uridine, where a methyl group is attached to the uracil base at the N3 position. Typically found in certain tRNAs, it helps maintain structural integrity and influences proper function during protein synthesis. This post-transcriptional modification assists in stabilizing the tRNA’s conformation, ensuring accurate codon-anticodon interactions. The presence of 3-methyluridine is part of a broader set of chemical modifications that expand tRNA’s chemical repertoire, contributing to the fine-tuning of gene expression and translation.
| CAS Number | 2140-69-4 |
| Molecular Formula | C₁₀H₁₄N₂O₆ |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-methylpyrimidine-2,4-dione |
| InChI | 1S/C10H14N2O6/c1-11-6(14)2-3-12(10(11)17)9-8(16)7(15)5(4-13)18-9/h2-3,5,7-9,13,15-16H,4H2,1H3/t5-,7-,8-,9-/m1/s1 |
| InChIKey | UTQUILVPBZEHTK-ZOQUXTDFSA-N |
| SMILES | CN1C(=O)C=CN(C1=O)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O |
| Reference | [1]. Rohan T Ranasinghe, et al. Detecting RNA base methylations in single cells by in situ hybridization. Nat Commun<br>[2]. From Wikipedia, 3-Methyluridine |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
