For research use only. Not for therapeutic Use.
3-N-BOC-3-(METHYLAMINO)PIPERIDINE (CAT: M033063) is a chemical compound commonly used in organic synthesis and pharmaceutical research. Its structure includes a piperidine ring functionalized with a tert-butoxycarbonyl (BOC) group at the 3rd position and a methylamino group at the same position. The tert-butoxycarbonyl group serves as a protecting group for the amine, allowing selective reactions at other functional groups in the molecule. The compound is widely used as an intermediate in the synthesis of various pharmaceutical compounds. The presence of the piperidine ring and the protected amine makes it a valuable building block for the preparation of diverse bioactive molecules and drug candidates.
CAS Number | 172478-01-2 |
Molecular Formula | C11H22N2O2 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | tert-butyl N-methyl-N-piperidin-3-ylcarbamate |
InChI | InChI=1S/C11H22N2O2/c1-11(2,3)15-10(14)13(4)9-6-5-7-12-8-9/h9,12H,5-8H2,1-4H3 |
InChIKey | RTXNDTNDOHQMTI-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)N(C)C1CCCNC1 |