For research use only. Not for therapeutic Use.
3-N-Boc-3-Methylbutane-1,3-diamine Hydrochloride is a protected diamine derivative widely used in peptide synthesis and medicinal chemistry. The Boc (tert-butyloxycarbonyl) protection at the amine group enhances its stability and allows for selective deprotection during synthetic routes. This compound features a branched alkyl chain, which contributes to its steric properties, making it suitable for creating conformationally constrained peptides. It is often utilized in the development of bioactive compounds and can serve as a valuable intermediate in synthesizing pharmaceuticals. The hydrochloride form enhances solubility, facilitating its use in various chemical and biological applications, particularly in drug discovery research.
| Catalog Number | R074022 |
| CAS Number | 1179359-61-5 |
| Molecular Formula | C10H23ClN2O2 |
| Purity | ≥95% |
| IUPAC Name | tert-butyl N-(4-amino-2-methylbutan-2-yl)carbamate;hydrochloride |
| InChI | InChI=1S/C10H22N2O2.ClH/c1-9(2,3)14-8(13)12-10(4,5)6-7-11;/h6-7,11H2,1-5H3,(H,12,13);1H |
| InChIKey | QNVUUFBWGBPXQW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C)(C)CCN.Cl |
