For research use only. Not for therapeutic Use.
3-O-Acetyloleanolic acid (Cat.No:R017254) is a natural triterpenoid compound derived from various plant sources. It exhibits potential anti-inflammatory, antioxidant, and antitumor properties. This compound has garnered attention for its therapeutic potential in traditional medicine and modern drug discovery, contributing to research in various health-related applications.
CAS Number | 4339-72-4 |
Molecular Formula | C32H50O4 |
Purity | ≥95% |
Target | Apoptosis |
Storage | 3 years -20℃ powder |
IUPAC Name | (4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-acetyloxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
InChI | InChI=1S/C32H50O4/c1-20(33)36-25-12-13-29(6)23(28(25,4)5)11-14-31(8)24(29)10-9-21-22-19-27(2,3)15-17-32(22,26(34)35)18-16-30(21,31)7/h9,22-25H,10-19H2,1-8H3,(H,34,35)/t22-,23-,24+,25-,29-,30+,31+,32-/m0/s1 |
InChIKey | RIXNFYQZWDGQAE-DFHVBEEKSA-N |
SMILES | CC(=O)OC1CCC2(C(C1(C)C)CCC3(C2CC=C4C3(CCC5(C4CC(CC5)(C)C)C(=O)O)C)C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |