For research use only. Not for therapeutic Use.
3-O-Methyl-D-glucose-6-13C（Cat No.:R041351） is a high-purity, isotopically labeled compound essential for advanced biochemical and pharmaceutical research. Featuring a 13C atom at the sixth position, this stable isotope-labeled version of 3-O-Methyl-D-glucose is crucial for studies on glucose metabolism, carbohydrate utilization, and metabolic pathways. 3-O-Methyl-D-glucose-6-13C aids in the development of therapeutic agents and enhances the understanding of metabolic processes and biochemical mechanisms, making it a valuable tool for scientific investigations and drug development.
| Catalog Number | R041351 |
| CAS Number | 478529-34-9 |
| Molecular Formula | C7H14O6 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (3R,4S,5R,6R)-6-(hydroxy(113C)methyl)-4-methoxyoxane-2,3,5-triol |
| InChI | InChI=1S/C7H14O6/c1-12-6-4(9)3(2-8)13-7(11)5(6)10/h3-11H,2H2,1H3/t3-,4-,5-,6+,7?/m1/s1/i2+1 |
| InChIKey | SCBBSJMAPKXHAH-PFXJGHEHSA-N |
| SMILES | CO[C@H]1[C@@H]([C@H](OC([C@@H]1O)O)[13CH2]O)O |
