For research use only. Not for therapeutic Use.
3-Oxo-1-phenyl-2,7,10,13,16-pentaoxa-4-azaoctadecan-18-oic acid(Cat No.:L016395), is a unique chemical compound with applications in organic synthesis and material science. It features a phenyl group, five ether oxygen atoms, and a nitrogen atom in its backbone, along with a keto group (3-oxo) and a carboxylic acid group. The compound’s diverse functional groups make it valuable for various chemical reactions and modifications.
CAS Number | 1451362-51-8 |
Molecular Formula | C18H27NO8 |
Purity | ≥95% |
IUPAC Name | 2-[2-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
InChI | InChI=1S/C18H27NO8/c20-17(21)15-26-13-12-25-11-10-24-9-8-23-7-6-19-18(22)27-14-16-4-2-1-3-5-16/h1-5H,6-15H2,(H,19,22)(H,20,21) |
InChIKey | CSUBNGPYLDOHIP-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)COC(=O)NCCOCCOCCOCCOCC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |