For research use only. Not for therapeutic Use.
3-Oxo-3-(3-trifluoromethylphenyl)propionic acid ethyl ester(Cat No.:M121891)is a chemical compound characterized by its trifluoromethylphenyl group and an ethyl ester linkage. This structure features a ketone functionality (3-oxo) adjacent to a propionic acid backbone, which is esterified with ethanol. The inclusion of the trifluoromethyl group significantly enhances the compound’s electronegativity and metabolic stability, making it a useful intermediate in pharmaceutical synthesis, particularly for drugs targeting metabolic disorders. The ethyl ester group improves solubility in organic solvents, facilitating its use in various synthetic pathways aimed at producing novel, biologically active molecules.
CAS Number | 1717-42-6 |
Molecular Formula | C12H11F3O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | ethyl 3-oxo-3-[3-(trifluoromethyl)phenyl]propanoate |
InChI | InChI=1S/C12H11F3O3/c1-2-18-11(17)7-10(16)8-4-3-5-9(6-8)12(13,14)15/h3-6H,2,7H2,1H3 |
InChIKey | YCHPVUWFIZXXPI-UHFFFAOYSA-N |
SMILES | CCOC(=O)CC(=O)C1=CC(=CC=C1)C(F)(F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |