For research use only. Not for therapeutic Use.
3-Oxo-4,6-choladien-24-oic acid is a steroidal compound found in bile acids. It is formed from cholesterol metabolism in the liver and plays a crucial role in lipid digestion and absorption in the gastrointestinal tract. Additionally, this acid serves as a precursor for the synthesis of bile salts, which aid in the emulsification and absorption of dietary fats.
CAS Number | 88179-71-9 |
Molecular Formula | C24H34O3 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | RT |
IUPAC Name | (4R)-4-[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-3-oxo-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
InChI | InChI=1S/C24H34O3/c1-15(4-9-22(26)27)19-7-8-20-18-6-5-16-14-17(25)10-12-23(16,2)21(18)11-13-24(19,20)3/h5-6,14-15,18-21H,4,7-13H2,1-3H3,(H,26,27)/t15-,18+,19-,20+,21+,23+,24-/m1/s1 |
InChIKey | CREVIXFSUWYGRJ-IHMUCKAYSA-N |
SMILES | CC(CCC(=O)O)C1CCC2C1(CCC3C2C=CC4=CC(=O)CCC34C)C |