For research use only. Not for therapeutic Use.
3-Oxo-N-[(3S)-tetrahydro-2-oxo-3-furanyl]dodecanamide(Cat No.:M134958)is a bioactive compound used in pharmaceutical research, particularly in studies involving enzyme inhibition and molecular interactions. This molecule features a dodecanamide backbone, linked to a tetrahydrofuran ring with a ketone group. Its unique structure, incorporating both a furan and amide group, makes it useful for investigating metabolic pathways and potential therapeutic applications. It may serve as a lead compound in drug discovery, especially targeting enzymes involved in inflammation and metabolic disorders, offering valuable insights into molecular drug design.
CAS Number | 168982-69-2 |
Synonyms | 3-oxo-N-[(3S)-tetrahydro-2-oxo-3-furanyl]-dodecanamide |
Molecular Formula | C16H27NO4 |
Purity | ≥95% |
Target | Bacterial |
Solubility | Soluble in DMSO |
Storage | Store at -20°C |
IUPAC Name | 3-oxo-N-[(3S)-2-oxooxolan-3-yl]dodecanamide |
InChI | InChI=1S/C16H27NO4/c1-2-3-4-5-6-7-8-9-13(18)12-15(19)17-14-10-11-21-16(14)20/h14H,2-12H2,1H3,(H,17,19)/t14-/m0/s1 |
InChIKey | PHSRRHGYXQCRPU-AWEZNQCLSA-N |
SMILES | CCCCCCCCCC(=O)CC(=O)N[C@H]1CCOC1=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |