For research use only. Not for therapeutic Use.
(3-(Pent-4-ynamido)phenyl)boronic acid (Cat.No:L003663) is a crucial compound in organic synthesis. Its unique structure, containing both a boronic acid and an alkyne group, makes it a valuable reagent in Suzuki-Miyaura cross-coupling reactions. This enables the construction of complex molecules, particularly in the field of medicinal chemistry.
CAS Number | 1392407-74-7 |
Molecular Formula | C11H12BNO3 |
Purity | ≥95% |
IUPAC Name | [3-(pent-4-ynoylamino)phenyl]boronic acid |
InChI | InChI=1S/C11H12BNO3/c1-2-3-7-11(14)13-10-6-4-5-9(8-10)12(15)16/h1,4-6,8,15-16H,3,7H2,(H,13,14) |
InChIKey | IRSBVOCSDOYNOX-UHFFFAOYSA-N |
SMILES | B(C1=CC(=CC=C1)NC(=O)CCC#C)(O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |