For research use only, not for therapeutic use.
3-Pentadecylphenol is a long-chain alkyl phenol characterized by a pentadecyl group attached to the 3-position of a phenolic ring. This structure imparts unique physical and chemical properties, enhancing its hydrophobicity and potential applications in various fields. The phenolic hydroxyl group contributes to its reactivity, allowing for potential applications in surfactants, lubricants, and antimicrobial agents. This compound may also be explored for use in materials science and organic synthesis, serving as a building block for developing more complex chemical structures.
| Catalog Number | L014768 |
| CAS Number | 501-24-6 |
| Molecular Formula | C21H36O |
| Purity | ≥95% |
| IUPAC Name | 3-pentadecylphenol |
| InChI | InChI=1S/C21H36O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-20-17-15-18-21(22)19-20/h15,17-19,22H,2-14,16H2,1H3 |
| InChIKey | PTFIPECGHSYQNR-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCCCCCCC1=CC(=CC=C1)O |
