For research use only. Not for therapeutic Use.
3-Pentanol（Cat No.:R062486）is a high-purity alcohol used in various chemical and pharmaceutical applications. As a secondary alcohol, it plays a crucial role in organic synthesis, acting as a solvent and intermediate in the production of more complex compounds. It is commonly utilized in the formulation of flavors, fragrances, and as a reagent in laboratory research. Its chemical stability and relatively low toxicity make it suitable for use in biochemical studies, especially those involving enzymatic reactions and metabolic processes. 3-Pentanol is also employed in industrial applications such as solvent extraction and chemical analysis.
| Catalog Number | R062486 |
| CAS Number | 584-02-1 |
| Synonyms | 1-Ethyl-1-propanol; 1-Ethylpropyl Alcohol; 3-Pentyl Alcohol; Diethyl Carbinol; NSC 8654; sec-Amyl Alcohol; sec-Pentanol; sec-Pentyl Alcohol |
| Molecular Formula | C5H12O |
| Purity | ≥95% |
| Target | Bacterial |
| Storage | Store at -20°C |
| IUPAC Name | pentan-3-ol |
| InChI | InChI=1S/C5H12O/c1-3-5(6)4-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | AQIXEPGDORPWBJ-UHFFFAOYSA-N |
| SMILES | CCC(CC)O |
