For research use only. Not for therapeutic Use.
3-(Perfluorooctyl)-1,2-propenoxide（Cat No.:C001049） is a fluorinated epoxide compound with remarkable antibacterial properties. It contains a perfluorooctyl group attached to a propenoxide ring structure. This unique combination of fluorinated and epoxide functionalities contributes to its potent antibacterial activity. As a result, it finds applications in various antibacterial formulations and products, particularly in the healthcare and personal care industries. Its fluorinated nature imparts resistance to degradation and environmental persistence.
| CAS Number | 38565-53-6 |
| Synonyms | 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-Heptadecafluorononyl)oxirane; (2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-Heptadecafluorononyl)oxirane; 1,2-Epoxy-1H,1H,2H,3H,3H-heptadecafluoroundecane; 1,2-Epoxy-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecane; 3-(2-Perfluoro-n-octyl)-1,2-epoxypropane; 3-(Perfluorooctyl)propylene Oxide; 3-Perfluorooctyl-1,2-epoxypropane; 3-Perfluorooctyl-1,2-propene Oxide; H 010; [(Perfluorooctyl)methyl]oxirane; |
| Molecular Formula | C₁₁H₅F₁₇O |
| Purity | ≥95% |
| Solubility | Chloroform (Soluble), Methanol (Slightly) |
| Appearance | Colourless Oil |
| Storage | 4°C, Inert atmosphere |
| IUPAC Name | 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononyl)oxirane |
| InChI | InChI=1S/C11H5F17O/c12-4(13,1-3-2-29-3)5(14,15)6(16,17)7(18,19)8(20,21)9(22,23)10(24,25)11(26,27)28/h3H,1-2H2 |
| InChIKey | HMXSIEIEXLGIET-UHFFFAOYSA-N |
| SMILES | C1C(O1)CC(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
