For research use only. Not for therapeutic Use.
3-Phenanthrenebutanoic Acid(CAT: R031062) is an organic compound belonging to the class of carboxylic acids. Its mode of action involves being a derivative of phenanthrene, a polycyclic aromatic hydrocarbon. Pharmacologically, 3-Phenanthrenebutanoic Acid is not used as a therapeutic drug. Instead, it might find applications in organic synthesis and as a reference standard in analytical chemistry and research. Its structure suggests it may have potential uses as an intermediate in the synthesis of other organic compounds or as a starting material for the preparation of specialized chemicals.
| Catalog Number | R031062 |
| CAS Number | 13728-56-8 |
| Synonyms | 3-Phenanthrenebutyric Acid; NSC 92828 |
| Molecular Formula | C18H16O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4-phenanthren-3-ylbutanoic acid |
| InChI | InChI=1S/C18H16O2/c19-18(20)7-3-4-13-8-9-15-11-10-14-5-1-2-6-16(14)17(15)12-13/h1-2,5-6,8-12H,3-4,7H2,(H,19,20) |
| InChIKey | NYIVWTWKIQOBKO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C=C(C=C3)CCCC(=O)O |
