For research use only. Not for therapeutic Use.
3-Phenanthrenebutanoic acid(Cat No.:R031062)is a synthetic compound with a phenanthrene backbone, widely used in chemical and pharmaceutical research. Known for its structural complexity, it serves as a precursor in the synthesis of bioactive molecules and is studied for its potential applications in drug discovery. This compound is valuable for exploring receptor-ligand interactions and developing novel therapeutic agents. Its stability and unique chemical properties make 3-Phenanthrenebutanoic acid a critical tool in medicinal chemistry, contributing to advancements in understanding biochemical pathways and designing innovative pharmaceuticals.
CAS Number | 13728-56-8 |
Synonyms | 3-Phenanthrenebutyric Acid; NSC 92828 |
Molecular Formula | C18H16O2 |
Purity | ≥95% |
Target | HIV |
Storage | -20°C |
IUPAC Name | 4-phenanthren-3-ylbutanoic acid |
InChI | InChI=1S/C18H16O2/c19-18(20)7-3-4-13-8-9-15-11-10-14-5-1-2-6-16(14)17(15)12-13/h1-2,5-6,8-12H,3-4,7H2,(H,19,20) |
InChIKey | NYIVWTWKIQOBKO-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C=CC3=C2C=C(C=C3)CCCC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |