For research use only. Not for therapeutic Use.
3-Phenanthrol is an aromatic organic compound used in biochemical and pharmaceutical research. Known for its potential biological activity, it is essential for studying the pharmacological properties and mechanisms of action of polycyclic aromatic hydrocarbons (PAHs). This compound aids in understanding metabolic pathways, enzyme interactions, and the development of new therapeutic agents. Researchers rely on 3-Phenanthrol for precise and reliable results in advanced studies of biochemistry, toxicology, and drug development, contributing significantly to innovations in medicinal chemistry and environmental health.
CAS Number | 605-87-8 |
Synonyms | 3-Phenanthrenol; 3-Hydroxyphenanthrene; NSC 30984; |
Molecular Formula | C14H10O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | phenanthren-3-ol |
InChI | InChI=1S/C14H10O/c15-12-8-7-11-6-5-10-3-1-2-4-13(10)14(11)9-12/h1-9,15H |
InChIKey | NGPOABOEXMDQBT-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C=CC3=C2C=C(C=C3)O |