For research use only. Not for therapeutic Use.
3-Phenyl-2-cyclopenten-1-one(Cat No.:L030068)is an organic compound used in pharmaceutical research and organic synthesis. The molecule features a cyclopentenone ring with a phenyl group attached at the 3-position, offering unique reactivity and structural properties. This compound is particularly valuable as an intermediate in the synthesis of complex molecules, including potential drug candidates and fine chemicals. The conjugated ketone and aromatic ring system allow for diverse chemical transformations, making it an essential building block for researchers focused on drug discovery, medicinal chemistry, and the development of advanced synthetic materials.
CAS Number | 3810-26-2 |
Molecular Formula | C11H10O |
Purity | ≥95% |
IUPAC Name | 3-phenylcyclopent-2-en-1-one |
InChI | InChI=1S/C11H10O/c12-11-7-6-10(8-11)9-4-2-1-3-5-9/h1-5,8H,6-7H2 |
InChIKey | UHTNKICWCQWOBM-UHFFFAOYSA-N |
SMILES | C1CC(=O)C=C1C2=CC=CC=C2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |