For research use only. Not for therapeutic Use.
3-Phenylbutyric Acid(CAT: I015093) is an aromatic short-chain fatty acid with notable applications in biochemical and pharmaceutical research. This compound is a structural analog of phenylacetic acid and has been studied for its potential roles in modulating metabolic pathways, particularly in lipid metabolism and insulin sensitivity. Additionally, it serves as a precursor or intermediate in the synthesis of various pharmaceuticals and fine chemicals. 3-Phenylbutyric Acid is also used in research to explore its anti-inflammatory and neuroprotective properties, contributing to the understanding of its potential therapeutic applications in metabolic disorders and neurodegenerative diseases.
CAS Number | 4593-90-2 |
Molecular Formula | C₁₀H₁₂O₂ |
Purity | ≥95% |
Target | Endogenous Metabolite |
IUPAC Name | 3-phenylbutanoic acid |
InChI | InChI=1S/C10H12O2/c1-8(7-10(11)12)9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,11,12) |
InChIKey | ZZEWMYILWXCRHZ-UHFFFAOYSA-N |
SMILES | CC(CC(=O)O)C1=CC=CC=C1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |