For research use only. Not for therapeutic Use.
3-Phenylcyclobutanone is a cyclic ketone with a phenyl group attached to a cyclobutanone ring, widely used in organic synthesis and pharmaceutical research. Its strained four-membered ring and carbonyl group make it reactive, serving as a useful intermediate for constructing complex molecules, particularly in studies involving ring-opening reactions and stereoselective synthesis. This compound’s unique structure makes it valuable in medicinal chemistry, where it is used to develop bioactive compounds, providing insights into molecular interactions and pharmacokinetic properties.
| Catalog Number | L034530 |
| CAS Number | 52784-31-3 |
| Molecular Formula | C10H10O |
| Purity | ≥95% |
| IUPAC Name | 3-phenylcyclobutan-1-one |
| InChI | InChI=1S/C10H10O/c11-10-6-9(7-10)8-4-2-1-3-5-8/h1-5,9H,6-7H2 |
| InChIKey | BVQSFCUGCAZOJQ-UHFFFAOYSA-N |
| SMILES | C1C(CC1=O)C2=CC=CC=C2 |
